cas: 1215867-50-7 — see every product listed under this CAS number, including other names
2-(3,6-Dihydro-2,2-dimethyl-2H-pyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 1215867-50-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691968-100MG |
| cas | 1215867-50-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1263.11 Pln | |
| Fluorochem | 250mg | 2090.95 Pln | |
| Fluorochem | 500mg | 3767.44 Pln | |
| Fluorochem | 1g | 5318.98 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(6,6-dimethyl-2,5-dihydropyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1215867-50-7) is a chemical compound with the molecular formula C13H23BO3 and a molecular weight of 238.13 g/mol. IUPAC name: 2-(6,6-dimethyl-2,5-dihydropyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CCGVKRLBJQCNMK-UHFFFAOYSA-N.
| Molecular formula | C13H23BO3 |
|---|---|
| Molecular weight | 238.13 g/mol |
| IUPAC name | 2-(6,6-dimethyl-2,5-dihydropyran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CCGVKRLBJQCNMK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCOC(C2)(C)C |
Computed by PubChem (NCBI)