cas: 1185428-46-9 — see every product listed under this CAS number, including other names
2-(3-((4-Methoxybenzyl)oxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 1185428-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F982990-100MG |
| cas | 1185428-46-9 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 841.39 Pln | |
| Fluorochem | 1g | 1632.78 Pln | |
| Fluorochem | 5g | 4183.96 Pln | |
| Fluorochem | 10g | 6943.41 Pln | |
| Chemat | 250mg | 669.20 Pln | |
| Chemat | 1g | 1278.80 Pln | |
| Chemat | 5g | 3213.20 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-[3-[(4-methoxyphenyl)methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1185428-46-9) is a chemical compound with the molecular formula C20H25BO4 and a molecular weight of 340.2 g/mol. IUPAC name: 2-[3-[(4-methoxyphenyl)methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KDLBLUSIEHSCPM-UHFFFAOYSA-N.
| Molecular formula | C20H25BO4 |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 2-[3-[(4-methoxyphenyl)methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KDLBLUSIEHSCPM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)