CAS 2121514-22-3 is the registry number for 2-(3-(Benzyloxy)-2-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
2-(2-methoxy-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-22-3) is a chemical compound with the molecular formula C20H25BO4 and a molecular weight of 340.2 g/mol. IUPAC name: 2-(2-methoxy-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BGBISNYOHDIAQH-UHFFFAOYSA-N.
| Molecular formula | C20H25BO4 |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 2-(2-methoxy-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BGBISNYOHDIAQH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)OCC3=CC=CC=C3)OC |
Computed by PubChem (NCBI)