2-(3-(Difluoromethyl)-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%
cas: 2304635-41-2 — see every product listed under this CAS number, including other names
2-(3-(Difluoromethyl)-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 2304635-41-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A814724-100mg |
| cas | 2304635-41-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 1427.25 Pln | |
| BLDpharm | 100mg | 225.50 Pln | |
| BLDpharm | 250mg | 442.09 Pln | |
| BLDpharm | 1g | 1536.15 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Fluorochem | 100mg | 211.40 Pln | |
| Fluorochem | 250mg | 398.84 Pln | |
| Fluorochem | 1g | 1086.09 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-[3-(difluoromethyl)-5-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2304635-41-2) is a chemical compound with the molecular formula C14H19BF2O3 and a molecular weight of 284.11 g/mol. IUPAC name: 2-[3-(difluoromethyl)-5-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UAVPBGRBTOOFJB-UHFFFAOYSA-N.
| Molecular formula | C14H19BF2O3 |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | 2-[3-(difluoromethyl)-5-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UAVPBGRBTOOFJB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OC)C(F)F |
Computed by PubChem (NCBI)
Synonyms:
1,3,2-Dioxaborolane, 2-[3-(difluoromethyl)-5-methoxyphenyl]-4,4,5,5-tetramethyl-, 2-[3-(difluoromethyl)-5-methoxy-phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-[3-(difluoromethyl)-5-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(3-(Difluoromethyl)-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolan