CAS 2121512-38-5 appears in our catalog under these names: 2,5-Difluoro-4-ethoxyphenylboronic acid pinacol ester, 95%, 2-(4-Ethoxy-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 2,5-Difluoro-4-ethoxyphenylboronic acid pinacol ester. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(4-ethoxy-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121512-38-5) is a chemical compound with the molecular formula C14H19BF2O3 and a molecular weight of 284.11 g/mol. IUPAC name: 2-(4-ethoxy-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GQZWHHMDIKMZSH-UHFFFAOYSA-N.
| Molecular formula | C14H19BF2O3 |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | 2-(4-ethoxy-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GQZWHHMDIKMZSH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)OCC)F |
Computed by PubChem (NCBI)