2-(3-(Morpholinomethyl)imidazo[2,1-b]thiazol-6-yl)aniline, 98%
cas: 1056562-54-9 — see every product listed under this CAS number, including other names
2-(3-(Morpholinomethyl)imidazo[2,1-b]thiazol-6-yl)aniline, 98% (CAS 1056562-54-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A697603-250mg |
| cas | 1056562-54-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1265.94 Pln | |
| Ambeed | 1g | 3296.25 Pln | |
| Chemat | 50mg | 515.60 Pln | |
| Chemat | 100mg | 827.60 Pln | |
| Chemat | 250mg | 1365.20 Pln | |
| Chemat | 1g | 3578.00 Pln | |
| BLDpharm | 50mg | 480.97 Pln | |
| BLDpharm | 100mg | 764.20 Pln | |
| BLDpharm | 250mg | 1247.36 Pln | |
| BLDpharm | 1g | 3230.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-[3-(morpholin-4-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]aniline (CAS 1056562-54-9) is a chemical compound with the molecular formula C16H18N4OS and a molecular weight of 314.4 g/mol. IUPAC name: 2-[3-(morpholin-4-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]aniline. InChIKey: NMFFOJAKROFEQG-UHFFFAOYSA-N.
| Molecular formula | C16H18N4OS |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 2-[3-(morpholin-4-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]aniline |
| InChIKey | NMFFOJAKROFEQG-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC2=CSC3=NC(=CN23)C4=CC=CC=C4N |
Computed by PubChem (NCBI)