Products 1022582-57-5
CAS 1022582-57-5 is the registry number for (4-(tert-butyl)phenyl)-N-((pyrimidin-2-ylamino)thioxomethyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-tert-butyl-N-(pyrimidin-2-ylcarbamothioyl)benzamide (CAS 1022582-57-5) is a chemical compound with the molecular formula C16H18N4OS and a molecular weight of 314.4 g/mol. IUPAC name: 4-tert-butyl-N-(pyrimidin-2-ylcarbamothioyl)benzamide. InChIKey: CHMHASHDKBUHSG-UHFFFAOYSA-N.
| Molecular formula | C16H18N4OS |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 4-tert-butyl-N-(pyrimidin-2-ylcarbamothioyl)benzamide |
| InChIKey | CHMHASHDKBUHSG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)NC(=S)NC2=NC=CC=N2 |
Computed by PubChem (NCBI)