cas: 52516-30-0 — see every product listed under this CAS number, including other names
2-(3-(Trifluoromethyl)phenyl)ethanamine, 98%, 98% (CAS 52516-30-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IAY-10g |
| cas | 52516-30-0 |
| size | 10g |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 160.40 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 25g | 304.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[3-(trifluoromethyl)phenyl]ethanamine (CAS 52516-30-0) is a chemical compound with the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]ethanamine. InChIKey: BPVYCXMGJPKOTQ-UHFFFAOYSA-N.
| Molecular formula | C9H10F3N |
|---|---|
| Molecular weight | 189.18 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]ethanamine |
| InChIKey | BPVYCXMGJPKOTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CCN |
Computed by PubChem (NCBI)