cas: 952480-32-9 — see every product listed under this CAS number, including other names
2-(3-(tert-Butoxycarbonyl)-3-azaspiro[5.5]undecan-9-yl)acetic acid 95% (CAS 952480-32-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A213196-100mg |
| cas | 952480-32-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1733.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A213196 |
2-[3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azaspiro[5.5]undecan-9-yl]acetic acid (CAS 952480-32-9) is a chemical compound with the molecular formula C17H29NO4 and a molecular weight of 311.4 g/mol. IUPAC name: 2-[3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azaspiro[5.5]undecan-9-yl]acetic acid. InChIKey: SKPPKBVHYIOFPC-UHFFFAOYSA-N.
| Molecular formula | C17H29NO4 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 2-[3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azaspiro[5.5]undecan-9-yl]acetic acid |
| InChIKey | SKPPKBVHYIOFPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(CC2)CC(=O)O)CC1 |
Computed by PubChem (NCBI)