cas: 952480-32-9 — see every product listed under this CAS number, including other names
2-(3-(tert-Butoxycarbonyl)-3-azaspiro(5.5)undecan-9-yl)acetic acid, 98% (CAS 952480-32-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 50mg, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A213196-5g |
| cas | 952480-32-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 18499.81 Pln | |
| AmBeed | 1g | 15303.40 Pln | |
| AmBeed | 50mg | 4268.95 Pln | |
| AmBeed | 250mg | 7686.70 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azaspiro[5.5]undecan-9-yl]acetic acid (CAS 952480-32-9) is a chemical compound with the molecular formula C17H29NO4 and a molecular weight of 311.4 g/mol. IUPAC name: 2-[3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azaspiro[5.5]undecan-9-yl]acetic acid. InChIKey: SKPPKBVHYIOFPC-UHFFFAOYSA-N.
| Molecular formula | C17H29NO4 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 2-[3-[(2-methylpropan-2-yl)oxycarbonyl]-3-azaspiro[5.5]undecan-9-yl]acetic acid |
| InChIKey | SKPPKBVHYIOFPC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(CC2)CC(=O)O)CC1 |
Computed by PubChem (NCBI)