cas: 1267403-79-1 — see every product listed under this CAS number, including other names
2-(3-Bromo-4-ethoxyphenyl)-1,3-dioxolane (CAS 1267403-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631071-1G |
| cas | 1267403-79-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1471.37 Pln | |
| Fluorochem | 5g | 4277.68 Pln |
| delivery time | 3-4 weeks |
|---|
2-(3-bromo-4-ethoxyphenyl)-1,3-dioxolane (CAS 1267403-79-1) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: 2-(3-bromo-4-ethoxyphenyl)-1,3-dioxolane. InChIKey: FOCRXINWABBXKW-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO3 |
|---|---|
| Molecular weight | 273.12 g/mol |
| IUPAC name | 2-(3-bromo-4-ethoxyphenyl)-1,3-dioxolane |
| InChIKey | FOCRXINWABBXKW-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C2OCCO2)Br |
Computed by PubChem (NCBI)