Products 81224-34-2
CAS 81224-34-2 appears in our catalog under these names: 2-(3-Bromo-4-methoxyphenyl)-2-methyl-1,3-dioxolane, 2-(3-Bromo-4-methoxyphenyl)-2-methyl-1,3-dioxolane, 97%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 5g, 10g, 25g, 100g, 1g.
2-(3-bromo-4-methoxyphenyl)-2-methyl-1,3-dioxolane (CAS 81224-34-2) is a chemical compound with the molecular formula C11H13BrO3 and a molecular weight of 273.12 g/mol. IUPAC name: 2-(3-bromo-4-methoxyphenyl)-2-methyl-1,3-dioxolane. InChIKey: UPGCPYYMXHKEBK-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO3 |
|---|---|
| Molecular weight | 273.12 g/mol |
| IUPAC name | 2-(3-bromo-4-methoxyphenyl)-2-methyl-1,3-dioxolane |
| InChIKey | UPGCPYYMXHKEBK-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=CC(=C(C=C2)OC)Br |
Computed by PubChem (NCBI)