cas: 374538-00-8 — see every product listed under this CAS number, including other names
2-(3-Bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane, 98% (CAS 374538-00-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620166-250MG |
| cas | 374538-00-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 737.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane (CAS 374538-00-8) is a chemical compound with the molecular formula C11H15BBrNO2 and a molecular weight of 283.96 g/mol. IUPAC name: 2-(3-bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane. InChIKey: CYGPBFLFZQMUBN-UHFFFAOYSA-N.
| Molecular formula | C11H15BBrNO2 |
|---|---|
| Molecular weight | 283.96 g/mol |
| IUPAC name | 2-(3-bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane |
| InChIKey | CYGPBFLFZQMUBN-UHFFFAOYSA-N |
| SMILES | B1(OCCN(CCO1)C)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)