CAS 2096334-82-4 appears in our catalog under these names: 4-Bromopyridin-3-ylboronic acid pinacol ester, 95%, 4-Bromopyridine-3-boronic acid pinacol ester, ≥95%, 4-Bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, ≥95%, ≥95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
4-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2096334-82-4) is a chemical compound with the molecular formula C11H15BBrNO2 and a molecular weight of 283.96 g/mol. IUPAC name: 4-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: AKTDHSFOZLYERP-UHFFFAOYSA-N.
| Molecular formula | C11H15BBrNO2 |
|---|---|
| Molecular weight | 283.96 g/mol |
| IUPAC name | 4-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | AKTDHSFOZLYERP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2)Br |
Computed by PubChem (NCBI)