cas: 750624-69-2 — see every product listed under this CAS number, including other names
2-(3-Bromophenyl)thiazole-4-carbaldehyde, 95% (CAS 750624-69-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224227-100MG |
| cas | 750624-69-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 830.98 Pln | |
| Fluorochem | 1g | 2111.77 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-bromophenyl)-1,3-thiazole-4-carbaldehyde (CAS 750624-69-2) is a chemical compound with the molecular formula C10H6BrNOS and a molecular weight of 268.13 g/mol. IUPAC name: 2-(3-bromophenyl)-1,3-thiazole-4-carbaldehyde. InChIKey: YNXSRZKASQSOPO-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNOS |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 2-(3-bromophenyl)-1,3-thiazole-4-carbaldehyde |
| InChIKey | YNXSRZKASQSOPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NC(=CS2)C=O |
Computed by PubChem (NCBI)