CAS 914348-78-0 is the registry number for 2-(4-Bromophenyl)thiazole-5-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg.
2-(4-bromophenyl)-1,3-thiazole-5-carbaldehyde (CAS 914348-78-0) is a chemical compound with the molecular formula C10H6BrNOS and a molecular weight of 268.13 g/mol. IUPAC name: 2-(4-bromophenyl)-1,3-thiazole-5-carbaldehyde. InChIKey: IIAXARYULRUREE-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNOS |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,3-thiazole-5-carbaldehyde |
| InChIKey | IIAXARYULRUREE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(S2)C=O)Br |
Computed by PubChem (NCBI)