cas: 1256355-67-5 — see every product listed under this CAS number, including other names
2-(3-CYANOPHENYLMETHOXY)PHENYLBORONIC ACID, 95%, 95% (CAS 1256355-67-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111O67-100mg |
| cas | 1256355-67-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 520.40 Pln | |
| Chemat | 1g | 1432.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[2-[(3-cyanophenyl)methoxy]phenyl]boronic acid (CAS 1256355-67-5) is a chemical compound with the molecular formula C14H12BNO3 and a molecular weight of 253.06 g/mol. IUPAC name: [2-[(3-cyanophenyl)methoxy]phenyl]boronic acid. InChIKey: GLFQWDKMRRYVDL-UHFFFAOYSA-N.
| Molecular formula | C14H12BNO3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | [2-[(3-cyanophenyl)methoxy]phenyl]boronic acid |
| InChIKey | GLFQWDKMRRYVDL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OCC2=CC(=CC=C2)C#N)(O)O |
Computed by PubChem (NCBI)