CAS 1256355-78-8 is the registry number for 4-(3-Cyanophenylmethoxy)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[4-[(3-cyanophenyl)methoxy]phenyl]boronic acid (CAS 1256355-78-8) is a chemical compound with the molecular formula C14H12BNO3 and a molecular weight of 253.06 g/mol. IUPAC name: [4-[(3-cyanophenyl)methoxy]phenyl]boronic acid. InChIKey: WXDTXGCOBVDLQR-UHFFFAOYSA-N.
| Molecular formula | C14H12BNO3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | [4-[(3-cyanophenyl)methoxy]phenyl]boronic acid |
| InChIKey | WXDTXGCOBVDLQR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=CC(=CC=C2)C#N)(O)O |
Computed by PubChem (NCBI)