cas: 635305-47-4 — see every product listed under this CAS number, including other names
2-(3-Chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97% (CAS 635305-47-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A128456-1g |
| cas | 635305-47-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 10g | 209.06 Pln | |
| Ambeed | 25g | 364.81 Pln | |
| Ambeed | 100g | 1238.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A128456 |
2-(3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 635305-47-4) is a chemical compound with the molecular formula C12H16BClO2 and a molecular weight of 238.52 g/mol. IUPAC name: 2-(3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CHQKHVZXPNHWEA-UHFFFAOYSA-N.
| Molecular formula | C12H16BClO2 |
|---|---|
| Molecular weight | 238.52 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CHQKHVZXPNHWEA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)