cas: 635305-47-4 — see every product listed under this CAS number, including other names
2-(3-Chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97% (CAS 635305-47-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EB58-1g |
| cas | 635305-47-4 |
| size | 1g |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 155.60 Pln | |
| Chemat | 25g | 280.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 635305-47-4) is a chemical compound with the molecular formula C12H16BClO2 and a molecular weight of 238.52 g/mol. IUPAC name: 2-(3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CHQKHVZXPNHWEA-UHFFFAOYSA-N.
| Molecular formula | C12H16BClO2 |
|---|---|
| Molecular weight | 238.52 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CHQKHVZXPNHWEA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)