cas: 627525-99-9 — see every product listed under this CAS number, including other names
2-(3-Ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95% (CAS 627525-99-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A793273-250mg |
| cas | 627525-99-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 698.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A793273 |
2-(3-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 627525-99-9) is a chemical compound with the molecular formula C14H19BO2 and a molecular weight of 230.11 g/mol. IUPAC name: 2-(3-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BXAMYNCWLIRUPU-UHFFFAOYSA-N.
| Molecular formula | C14H19BO2 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2-(3-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BXAMYNCWLIRUPU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C=C |
Computed by PubChem (NCBI)