cas: 627525-99-9 — see every product listed under this CAS number, including other names
2-(3-Ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95% (CAS 627525-99-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IB3X-100mg |
| cas | 627525-99-9 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 510.80 Pln | |
| Chemat | 10g | 904.40 Pln | |
| Chemat | 25g | 1744.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(3-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 627525-99-9) is a chemical compound with the molecular formula C14H19BO2 and a molecular weight of 230.11 g/mol. IUPAC name: 2-(3-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BXAMYNCWLIRUPU-UHFFFAOYSA-N.
| Molecular formula | C14H19BO2 |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | 2-(3-ethenylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BXAMYNCWLIRUPU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C=C |
Computed by PubChem (NCBI)