cas: 1583286-47-8 — see every product listed under this CAS number, including other names
2-(3-Fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1583286-47-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627487-1G |
| cas | 1583286-47-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1997.23 Pln | |
| Fluorochem | 5g | 5839.63 Pln |
| delivery time | 3-4 weeks |
|---|
2-(3-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1583286-47-8) is a chemical compound with the molecular formula C13H18BFO2 and a molecular weight of 236.09 g/mol. IUPAC name: 2-(3-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RSTYAXSJWWFJLG-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-(3-fluoro-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RSTYAXSJWWFJLG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)F)C |
Computed by PubChem (NCBI)