2-(3-Fluorophenoxy)aniline, 95+%
cas: 640766-67-2 — see every product listed under this CAS number, including other names
2-(3-Fluorophenoxy)aniline, 95+% (CAS 640766-67-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A186425-250mg |
| cas | 640766-67-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 553.94 Pln | |
| Ambeed | 1g | 1410.56 Pln | |
| Chemat | 100mg | 683.60 Pln | |
| Chemat | 250mg | 1168.40 Pln | |
| Chemat | 1g | 2795.60 Pln | |
| BLDpharm | 100mg | 442.09 Pln | |
| BLDpharm | 250mg | 586.48 Pln | |
| BLDpharm | 1g | 1513.94 Pln | |
| Fluorochem | 1g | 5183.61 Pln | |
| Fluorochem | 100mg | 1263.11 Pln | |
| Fluorochem | 250mg | 2163.84 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
2-(3-fluorophenoxy)aniline (CAS 640766-67-2) is a chemical compound with the molecular formula C12H10FNO and a molecular weight of 203.21 g/mol. IUPAC name: 2-(3-fluorophenoxy)aniline. InChIKey: OIZHDJAXAOGJCS-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO |
|---|---|
| Molecular weight | 203.21 g/mol |
| IUPAC name | 2-(3-fluorophenoxy)aniline |
| InChIKey | OIZHDJAXAOGJCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)OC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)