2-(3-Fluorophenyl)pyrimidin-5-amine, 95%
cas: 1094411-86-5 — see every product listed under this CAS number, including other names
2-(3-Fluorophenyl)pyrimidin-5-amine, 95% (CAS 1094411-86-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1110780-250mg |
| cas | 1094411-86-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 898.81 Pln | |
| Ambeed | 1g | 2367.31 Pln | |
| Ambeed | 5g | 6311.12 Pln | |
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1581.20 Pln | |
| Chemat | 5g | 5771.60 Pln | |
| BLDpharm | 100mg | 536.50 Pln | |
| BLDpharm | 250mg | 886.38 Pln | |
| BLDpharm | 1g | 2319.21 Pln | |
| BLDpharm | 5g | 6184.51 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(3-fluorophenyl)pyrimidin-5-amine (CAS 1094411-86-5) is a chemical compound with the molecular formula C10H8FN3 and a molecular weight of 189.19 g/mol. IUPAC name: 2-(3-fluorophenyl)pyrimidin-5-amine. InChIKey: AIHATZXQZIYIPB-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3 |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | 2-(3-fluorophenyl)pyrimidin-5-amine |
| InChIKey | AIHATZXQZIYIPB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC=C(C=N2)N |
Computed by PubChem (NCBI)