CAS 1260678-41-8 appears in our catalog under these names: 2-(2-Fluorophenyl)pyrimidin-5-amine 95%, 2-(2-Fluorophenyl)pyrimidin-5-amine, 95%, 95%, 2-(2-Fluorophenyl)-5-pyrimidinamine, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(2-fluorophenyl)pyrimidin-5-amine (CAS 1260678-41-8) is a chemical compound with the molecular formula C10H8FN3 and a molecular weight of 189.19 g/mol. IUPAC name: 2-(2-fluorophenyl)pyrimidin-5-amine. InChIKey: BNTGSPPSAUOLRX-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3 |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | 2-(2-fluorophenyl)pyrimidin-5-amine |
| InChIKey | BNTGSPPSAUOLRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=C(C=N2)N)F |
Computed by PubChem (NCBI)