cas: 755026-96-1 — see every product listed under this CAS number, including other names
2-(3-METHOXY-4-NITROPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE, 97% (CAS 755026-96-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F827099-1G |
| cas | 755026-96-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1216.26 Pln | |
| Fluorochem | 10g | 2262.76 Pln | |
| Fluorochem | 25g | 5542.86 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(3-methoxy-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 755026-96-1) is a chemical compound with the molecular formula C13H18BNO5 and a molecular weight of 279.10 g/mol. IUPAC name: 2-(3-methoxy-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BWLMLFOPBJWHOQ-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO5 |
|---|---|
| Molecular weight | 279.10 g/mol |
| IUPAC name | 2-(3-methoxy-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BWLMLFOPBJWHOQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)