CAS 1356943-81-1 is the registry number for 2-(5-Methoxy-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(5-methoxy-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1356943-81-1) is a chemical compound with the molecular formula C13H18BNO5 and a molecular weight of 279.10 g/mol. IUPAC name: 2-(5-methoxy-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CDGIBQKOAVGTOP-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO5 |
|---|---|
| Molecular weight | 279.10 g/mol |
| IUPAC name | 2-(5-methoxy-2-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CDGIBQKOAVGTOP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)