CAS 5454-06-8 appears in our catalog under these names: 2–(3–Phenylpropyl)propanedioic acid, 2-(3-Phenylpropyl)propanedioic acid, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-(3-phenylpropyl)propanedioic acid (CAS 5454-06-8) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 2-(3-phenylpropyl)propanedioic acid. InChIKey: KRZLPCLVDVLDJZ-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 2-(3-phenylpropyl)propanedioic acid |
| InChIKey | KRZLPCLVDVLDJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCC(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)