cas: 446311-34-8 — see every product listed under this CAS number, including other names
2-(4'-Methoxy-[1,1'-biphenyl]-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 446311-34-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696254-1G |
| cas | 446311-34-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 976.76 Pln | |
| Fluorochem | 5g | 2778.21 Pln |
| delivery time | 3-4 weeks |
|---|
2-[4-(4-methoxyphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 446311-34-8) is a chemical compound with the molecular formula C19H23BO3 and a molecular weight of 310.2 g/mol. IUPAC name: 2-[4-(4-methoxyphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XIWRWTPGYBTKPL-UHFFFAOYSA-N.
| Molecular formula | C19H23BO3 |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 2-[4-(4-methoxyphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XIWRWTPGYBTKPL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)