Products 1565857-83-1

CAS 1565857-83-1 is the registry number for 3'-Methoxybiphenyl-4-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[4-(3-methoxyphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1565857-83-1) is a chemical compound with the molecular formula C19H23BO3 and a molecular weight of 310.2 g/mol. IUPAC name: 2-[4-(3-methoxyphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QRLUQLVTOZYCSA-UHFFFAOYSA-N.

Identity
Molecular formulaC19H23BO3
Molecular weight310.2 g/mol
IUPAC name2-[4-(3-methoxyphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
InChIKeyQRLUQLVTOZYCSA-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC(=CC=C3)OC

Computed by PubChem (NCBI)