cas: 2121513-88-8 — see every product listed under this CAS number, including other names
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethoxy)benzaldehyde, 97%, 97% (CAS 2121513-88-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12QNUK-100mg |
| cas | 2121513-88-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 506.00 Pln | |
| Chemat | 250mg | 818.00 Pln | |
| Chemat | 1g | 1845.20 Pln | |
| Chemat | 5g | 5195.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethoxy)benzaldehyde (CAS 2121513-88-8) is a chemical compound with the molecular formula C14H16BF3O4 and a molecular weight of 316.08 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethoxy)benzaldehyde. InChIKey: BOKUYDUDPURYLB-UHFFFAOYSA-N.
| Molecular formula | C14H16BF3O4 |
|---|---|
| Molecular weight | 316.08 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethoxy)benzaldehyde |
| InChIKey | BOKUYDUDPURYLB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)OC(F)(F)F)C=O |
Computed by PubChem (NCBI)