CAS 1400976-18-2 is the registry number for 2-(Tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)benzoic acid (CAS 1400976-18-2) is a chemical compound with the molecular formula C14H16BF3O4 and a molecular weight of 316.08 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)benzoic acid. InChIKey: SWCOUWIBHDXHEY-UHFFFAOYSA-N.
| Molecular formula | C14H16BF3O4 |
|---|---|
| Molecular weight | 316.08 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)benzoic acid |
| InChIKey | SWCOUWIBHDXHEY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)