cas: 1187591-17-8 — see every product listed under this CAS number, including other names
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 95% (CAS 1187591-17-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F516347-100G |
| cas | 1187591-17-8 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 2111.77 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 10g | 315.53 Pln | |
| Fluorochem | 25g | 570.65 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1187591-17-8) is a chemical compound with the molecular formula C13H17BO4 and a molecular weight of 248.08 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: WEMYAYYFODFKCV-UHFFFAOYSA-N.
| Molecular formula | C13H17BO4 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | WEMYAYYFODFKCV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)