cas: 1187591-17-8 — see every product listed under this CAS number, including other names
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97%, 97% (CAS 1187591-17-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119SIO-250mg |
| cas | 1187591-17-8 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 25g | 448.40 Pln | |
| Chemat | 10g | 227.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1187591-17-8) is a chemical compound with the molecular formula C13H17BO4 and a molecular weight of 248.08 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: WEMYAYYFODFKCV-UHFFFAOYSA-N.
| Molecular formula | C13H17BO4 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | WEMYAYYFODFKCV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)