cas: 632325-55-4 — see every product listed under this CAS number, including other names
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbaldehyde (CAS 632325-55-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215023-5G |
| cas | 632325-55-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1762.94 Pln | |
| Fluorochem | 10g | 2955.23 Pln |
| delivery time | 3-4 weeks |
|---|
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbaldehyde (CAS 632325-55-4) is a chemical compound with the molecular formula C11H15BO3S and a molecular weight of 238.12 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbaldehyde. InChIKey: VKSNHTCPMPMGNN-UHFFFAOYSA-N.
| Molecular formula | C11H15BO3S |
|---|---|
| Molecular weight | 238.12 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbaldehyde |
| InChIKey | VKSNHTCPMPMGNN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CS2)C=O |
Computed by PubChem (NCBI)