CAS 632325-55-4 appears in our catalog under these names: 3-Formylthiophene-2-boronic acid pinacol ester, 98%, 3-Formylthiophene-2-boronic acid pinacol ester, ≥95%, ≥95%, 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbaldehyde. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbaldehyde (CAS 632325-55-4) is a chemical compound with the molecular formula C11H15BO3S and a molecular weight of 238.12 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbaldehyde. InChIKey: VKSNHTCPMPMGNN-UHFFFAOYSA-N.
| Molecular formula | C11H15BO3S |
|---|---|
| Molecular weight | 238.12 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carbaldehyde |
| InChIKey | VKSNHTCPMPMGNN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CS2)C=O |
Computed by PubChem (NCBI)