cas: 1402238-25-8 — see every product listed under this CAS number, including other names
2-(4-(BROMOMETHYL)-3-CHLOROPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE, 98% (CAS 1402238-25-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F838520-25G |
| cas | 1402238-25-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 4704.61 Pln | |
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1388.07 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[4-(bromomethyl)-3-chlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1402238-25-8) is a chemical compound with the molecular formula C13H17BBrClO2 and a molecular weight of 331.44 g/mol. IUPAC name: 2-[4-(bromomethyl)-3-chlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VMYBBVYMLVXREL-UHFFFAOYSA-N.
| Molecular formula | C13H17BBrClO2 |
|---|---|
| Molecular weight | 331.44 g/mol |
| IUPAC name | 2-[4-(bromomethyl)-3-chlorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VMYBBVYMLVXREL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CBr)Cl |
Computed by PubChem (NCBI)