cas: 2121513-92-4 — see every product listed under this CAS number, including other names
2-(4-(Benzyloxy)-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97% (CAS 2121513-92-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A917709-250mg |
| cas | 2121513-92-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1093.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A917709 |
2-(3,5-dimethyl-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121513-92-4) is a chemical compound with the molecular formula C21H27BO3 and a molecular weight of 338.2 g/mol. IUPAC name: 2-(3,5-dimethyl-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OYZFBHUJAVTFEF-UHFFFAOYSA-N.
| Molecular formula | C21H27BO3 |
|---|---|
| Molecular weight | 338.2 g/mol |
| IUPAC name | 2-(3,5-dimethyl-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OYZFBHUJAVTFEF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)C)OCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)