cas: 1000796-87-1 — see every product listed under this CAS number, including other names
2-(4-(Benzyloxy)-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95% (CAS 1000796-87-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1111U8-100mg |
| cas | 1000796-87-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(3-methoxy-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1000796-87-1) is a chemical compound with the molecular formula C20H25BO4 and a molecular weight of 340.2 g/mol. IUPAC name: 2-(3-methoxy-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: AZHNNODKZBIADS-UHFFFAOYSA-N.
| Molecular formula | C20H25BO4 |
|---|---|
| Molecular weight | 340.2 g/mol |
| IUPAC name | 2-(3-methoxy-4-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | AZHNNODKZBIADS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OCC3=CC=CC=C3)OC |
Computed by PubChem (NCBI)