cas: 2410032-62-9 — see every product listed under this CAS number, including other names
2-(4-(Difluoromethyl)-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 2410032-62-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg. Offered by: AmBeed, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A1940643-5g |
| cas | 2410032-62-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 25459.00 Pln | |
| Ambeed | 100mg | 1288.19 Pln | |
| Ambeed | 250mg | 2028.00 Pln | |
| Ambeed | 1g | 4992.81 Pln | |
| Chemat | 100mg | 813.20 Pln | |
| Chemat | 250mg | 1274.00 Pln | |
| Chemat | 500mg | 2094.80 Pln | |
| Chemat | 1g | 3102.80 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[4-(difluoromethyl)-2-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2410032-62-9) is a chemical compound with the molecular formula C13H16BF3O2 and a molecular weight of 272.07 g/mol. IUPAC name: 2-[4-(difluoromethyl)-2-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QLCODUJDFFPVGJ-UHFFFAOYSA-N.
| Molecular formula | C13H16BF3O2 |
|---|---|
| Molecular weight | 272.07 g/mol |
| IUPAC name | 2-[4-(difluoromethyl)-2-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QLCODUJDFFPVGJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(F)F)F |
Computed by PubChem (NCBI)