Products 2225169-61-7
CAS 2225169-61-7 is the registry number for 3–Trifluoromethyl–5–(cyclohexyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[3-cyclohexyl-5-(trifluoromethyl)phenyl]boronic acid (CAS 2225169-61-7) is a chemical compound with the molecular formula C13H16BF3O2 and a molecular weight of 272.07 g/mol. IUPAC name: [3-cyclohexyl-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: DYXSJTXYWYDKIO-UHFFFAOYSA-N.
| Molecular formula | C13H16BF3O2 |
|---|---|
| Molecular weight | 272.07 g/mol |
| IUPAC name | [3-cyclohexyl-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | DYXSJTXYWYDKIO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(F)(F)F)C2CCCCC2)(O)O |
Computed by PubChem (NCBI)