cas: 1310949-75-7 — see every product listed under this CAS number, including other names
2-(4-(Difluoromethyl)-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95% (CAS 1310949-75-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BIP0-100mg |
| cas | 1310949-75-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 914.00 Pln | |
| Chemat | 250mg | 1485.20 Pln | |
| Chemat | 1g | 2910.80 Pln | |
| Chemat | 5g | 4830.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[4-(difluoromethyl)-3-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1310949-75-7) is a chemical compound with the molecular formula C13H16BF3O2 and a molecular weight of 272.07 g/mol. IUPAC name: 2-[4-(difluoromethyl)-3-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CTHDVQSPTKBIQC-UHFFFAOYSA-N.
| Molecular formula | C13H16BF3O2 |
|---|---|
| Molecular weight | 272.07 g/mol |
| IUPAC name | 2-[4-(difluoromethyl)-3-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CTHDVQSPTKBIQC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(F)F)F |
Computed by PubChem (NCBI)