cas: 1073354-54-7 — see every product listed under this CAS number, including other names
2-(4-BOC-PIPERAZIN-1-YL)-3-METHYLPYRIDINE-5-BORONIC ACID PINACOL ESTER, 97%, 97% (CAS 1073354-54-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UJZ-100mg |
| cas | 1073354-54-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 2762.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate (CAS 1073354-54-7) is a chemical compound with the molecular formula C21H34BN3O4 and a molecular weight of 403.3 g/mol. IUPAC name: tert-butyl 4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate. InChIKey: OQIMQZMFVHOVSR-UHFFFAOYSA-N.
| Molecular formula | C21H34BN3O4 |
|---|---|
| Molecular weight | 403.3 g/mol |
| IUPAC name | tert-butyl 4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate |
| InChIKey | OQIMQZMFVHOVSR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)N3CCN(CC3)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)