cas: 1073354-54-7 — see every product listed under this CAS number, including other names
Tert-butyl 4-(3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)piperazine-1-carboxylate, 96% (CAS 1073354-54-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691446-100MG |
| cas | 1073354-54-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1028.82 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate (CAS 1073354-54-7) is a chemical compound with the molecular formula C21H34BN3O4 and a molecular weight of 403.3 g/mol. IUPAC name: tert-butyl 4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate. InChIKey: OQIMQZMFVHOVSR-UHFFFAOYSA-N.
| Molecular formula | C21H34BN3O4 |
|---|---|
| Molecular weight | 403.3 g/mol |
| IUPAC name | tert-butyl 4-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine-1-carboxylate |
| InChIKey | OQIMQZMFVHOVSR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)N3CCN(CC3)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)