cas: 2221812-22-0 — see every product listed under this CAS number, including other names
2-(4-Bromo-2-chlorophenyl)-1,3-dioxolane 95% (CAS 2221812-22-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1634442-100mg |
| cas | 2221812-22-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 670.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1634442 |
2-(4-bromo-2-chlorophenyl)-1,3-dioxolane (CAS 2221812-22-0) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: 2-(4-bromo-2-chlorophenyl)-1,3-dioxolane. InChIKey: VNHYLOZHVPHTQS-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | 2-(4-bromo-2-chlorophenyl)-1,3-dioxolane |
| InChIKey | VNHYLOZHVPHTQS-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)