CAS 915707-62-9 is the registry number for 2-(4-Bromophenoxy)-6-methylpyrazine, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 5g.
2-(4-bromophenoxy)-6-methylpyrazine (CAS 915707-62-9) is a chemical compound with the molecular formula C11H9BrN2O and a molecular weight of 265.11 g/mol. IUPAC name: 2-(4-bromophenoxy)-6-methylpyrazine. InChIKey: VJZHVPRWFQZLGM-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O |
|---|---|
| Molecular weight | 265.11 g/mol |
| IUPAC name | 2-(4-bromophenoxy)-6-methylpyrazine |
| InChIKey | VJZHVPRWFQZLGM-UHFFFAOYSA-N |
| SMILES | CC1=CN=CC(=N1)OC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)