CAS 1141669-55-7 appears in our catalog under these names: 3'-Bromo-4'-(1h-imidazol-1-yl)acetophenone, 97%, 3’–Bromo–4’–(1–imidazolyl)acetophenone, 3'-Bromo-4'-(1H-imidazol-1-yl)acetophenone, >97%, >97%, 1-(3-Bromo-4-(1H-imidazol-1-yl)phenyl)ethanone. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 25g.
1-(3-bromo-4-imidazol-1-ylphenyl)ethanone (CAS 1141669-55-7) is a chemical compound with the molecular formula C11H9BrN2O and a molecular weight of 265.11 g/mol. IUPAC name: 1-(3-bromo-4-imidazol-1-ylphenyl)ethanone. InChIKey: YXCHZUPKBMZDGO-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O |
|---|---|
| Molecular weight | 265.11 g/mol |
| IUPAC name | 1-(3-bromo-4-imidazol-1-ylphenyl)ethanone |
| InChIKey | YXCHZUPKBMZDGO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)N2C=CN=C2)Br |
Computed by PubChem (NCBI)