cas: 21166-30-3 — see every product listed under this CAS number, including other names
2-(4-Bromophenyl)thiazole-4-carbaldehyde, 98%, 98% (CAS 21166-30-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BCUA-100mg |
| cas | 21166-30-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 448.40 Pln | |
| Chemat | 1g | 947.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-bromophenyl)-1,3-thiazole-4-carbaldehyde (CAS 21166-30-3) is a chemical compound with the molecular formula C10H6BrNOS and a molecular weight of 268.13 g/mol. IUPAC name: 2-(4-bromophenyl)-1,3-thiazole-4-carbaldehyde. InChIKey: KOMFNSXHHNSAFR-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNOS |
|---|---|
| Molecular weight | 268.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,3-thiazole-4-carbaldehyde |
| InChIKey | KOMFNSXHHNSAFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C=O)Br |
Computed by PubChem (NCBI)