cas: 6258-30-6 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-2-methylpropanoic acid, 95%, 95% (CAS 6258-30-6) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E0FF-200mg |
| cas | 6258-30-6 |
| size | 200mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 131.60 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 861.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-chlorophenyl)-2-methylpropanoic acid (CAS 6258-30-6) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-methylpropanoic acid. InChIKey: SSFDAZXGUKDEAH-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-methylpropanoic acid |
| InChIKey | SSFDAZXGUKDEAH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)